C22H25FN4O4S — CID 30894608
[4-(2-fluorobenzoyl)piperazin-1-yl]-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone (PubChem CID 30894608) has the molecular formula C22H25FN4O4S and a molecular weight of 460.53 g/mol. Its IUPAC name is [4-(2-fluorobenzoyl)piperazin-1-yl]-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone.
| Compound Name | [4-(2-fluorobenzoyl)piperazin-1-yl]-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 30894608 |
| Molecular Formula | C22H25FN4O4S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | [4-(2-fluorobenzoyl)piperazin-1-yl]-(1-pyridin-3-ylsulfonylpiperidin-4-yl)methanone |
| SMILES | O=C(c1ccccc1F)N1CCN(C(=O)C2CCN(S(=O)(=O)c3cccnc3)CC2)CC1 |
| InChI | InChI=1S/C22H25FN4O4S/c23-20-6-2-1-5-19(20)22(29)26-14-12-25(13-15-26)21(28)17-7-10-27(11-8-17)32(30,31)18-4-3-9-24-16-18/h1-6,9,16-17H,7-8,10-15H2 |
| InChIKey | DBMHFHOIIGTHKZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 90.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |