C26H30N4O3S — CID 30900136
N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]-4-(phenylsulfamoyl)benzamide (PubChem CID 30900136) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]-4-(phenylsulfamoyl)benzamide.
| Compound Name | N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]-4-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 30900136 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]-4-(phenylsulfamoyl)benzamide |
| SMILES | Cc1cccc(N2CCN(CCNC(=O)c3ccc(S(=O)(=O)Nc4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C26H30N4O3S/c1-21-6-5-9-24(20-21)30-18-16-29(17-19-30)15-14-27-26(31)22-10-12-25(13-11-22)34(32,33)28-23-7-3-2-4-8-23/h2-13,20,28H,14-19H2,1H3,(H,27,31) |
| InChIKey | MJUNWOOIEHJZQA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |