C25H33N5O — CID 55760895
4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]benzamide (PubChem CID 55760895) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]benzamide.
| Compound Name | 4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 55760895 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-[3-[4-(3-methylphenyl)piperazin-1-yl]propyl]benzamide |
| SMILES | CC1=NN(c2ccc(C(=O)NCCCN3CCN(c4cccc(C)c4)CC3)cc2)CC1 |
| InChI | InChI=1S/C25H33N5O/c1-20-5-3-6-24(19-20)29-17-15-28(16-18-29)13-4-12-26-25(31)22-7-9-23(10-8-22)30-14-11-21(2)27-30/h3,5-10,19H,4,11-18H2,1-2H3,(H,26,31) |
| InChIKey | MZNHHBRKWIUTQA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|