C21H27N3O3S — CID 46462236
N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]-4-methylsulfonylbenzamide (PubChem CID 46462236) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 46462236 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[2-[4-(3-methylphenyl)piperazin-1-yl]ethyl]-4-methylsulfonylbenzamide |
| SMILES | Cc1cccc(N2CCN(CCNC(=O)c3ccc(S(C)(=O)=O)cc3)CC2)c1 |
| InChI | InChI=1S/C21H27N3O3S/c1-17-4-3-5-19(16-17)24-14-12-23(13-15-24)11-10-22-21(25)18-6-8-20(9-7-18)28(2,26)27/h3-9,16H,10-15H2,1-2H3,(H,22,25) |
| InChIKey | IUXAOSMQVAXQLK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |