C17H20N4O3S — CID 30921011
2-methyl-5-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]pyridazin-3-one (PubChem CID 30921011) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-methyl-5-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]pyridazin-3-one.
| Compound Name | 2-methyl-5-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 30921011 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-methyl-5-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]pyridazin-3-one |
| SMILES | Cn1ncc(N2CCN(S(=O)(=O)/C=C/c3ccccc3)CC2)cc1=O |
| InChI | InChI=1S/C17H20N4O3S/c1-19-17(22)13-16(14-18-19)20-8-10-21(11-9-20)25(23,24)12-7-15-5-3-2-4-6-15/h2-7,12-14H,8-11H2,1H3/b12-7+ |
| InChIKey | AMSVRUFNRSXBMB-KPKJPENVSA-N |
| XLogP | 0.90 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |