C17H17F3N4O2S — CID 36551467
2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine (PubChem CID 36551467) has the molecular formula C17H17F3N4O2S and a molecular weight of 398.41 g/mol. Its IUPAC name is 2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 36551467 |
| Molecular Formula | C17H17F3N4O2S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 2-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine |
| SMILES | O=S(=O)(/C=C/c1ccccc1)N1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C17H17F3N4O2S/c18-17(19,20)15-6-8-21-16(22-15)23-9-11-24(12-10-23)27(25,26)13-7-14-4-2-1-3-5-14/h1-8,13H,9-12H2/b13-7+ |
| InChIKey | YPBSGZZAXOBHGN-NTUHNPAUSA-N |
| XLogP | 2.62 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |