C22H23N3O4S2 — CID 34157363
3-methyl-8-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]sulfonylquinoline (PubChem CID 34157363) has the molecular formula C22H23N3O4S2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 3-methyl-8-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]sulfonylquinoline.
| Compound Name | 3-methyl-8-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 34157363 |
| Molecular Formula | C22H23N3O4S2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 3-methyl-8-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]sulfonylquinoline |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCN(S(=O)(=O)/C=C/c4ccccc4)CC3)cccc2c1 |
| InChI | InChI=1S/C22H23N3O4S2/c1-18-16-20-8-5-9-21(22(20)23-17-18)31(28,29)25-13-11-24(12-14-25)30(26,27)15-10-19-6-3-2-4-7-19/h2-10,15-17H,11-14H2,1H3/b15-10+ |
| InChIKey | WMLHMRGUSJXBTK-XNTDXEJSSA-N |
| XLogP | 2.85 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |