C14H16Cl2N4O2S — CID 30929132
3-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-4-amine (PubChem CID 30929132) has the molecular formula C14H16Cl2N4O2S and a molecular weight of 375.28 g/mol. Its IUPAC name is 3-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 30929132 |
| Molecular Formula | C14H16Cl2N4O2S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 3-[[(1S)-2,2-dichlorocyclopropyl]methylsulfanyl]-5-(3,4-dimethoxyphenyl)-1,2,4-triazol-4-amine |
| SMILES | COc1ccc(-c2nnc(SC[C@@H]3CC3(Cl)Cl)n2N)cc1OC |
| InChI | InChI=1S/C14H16Cl2N4O2S/c1-21-10-4-3-8(5-11(10)22-2)12-18-19-13(20(12)17)23-7-9-6-14(9,15)16/h3-5,9H,6-7,17H2,1-2H3/t9-/m0/s1 |
| InChIKey | NDKDJSDZCMPJLJ-VIFPVBQESA-N |
| XLogP | 2.96 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|