C16H21F3N4O2 — CID 30956417
(2S)-N-carbamoyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide (PubChem CID 30956417) has the molecular formula C16H21F3N4O2 and a molecular weight of 358.36 g/mol. Its IUPAC name is (2S)-N-carbamoyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide.
| Compound Name | (2S)-N-carbamoyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30956417 |
| Molecular Formula | C16H21F3N4O2 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | (2S)-N-carbamoyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide |
| SMILES | C[C@@H](C(=O)NC(N)=O)N1CCN(Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H21F3N4O2/c1-11(14(24)21-15(20)25)23-8-6-22(7-9-23)10-12-2-4-13(5-3-12)16(17,18)19/h2-5,11H,6-10H2,1H3,(H3,20,21,24,25)/t11-/m0/s1 |
| InChIKey | FPVSPLWLGWEDRE-NSHDSACASA-N |
| XLogP | 1.41 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |