C22H26F3N3O2 — CID 46632227
N-(4-methoxyphenyl)-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide (PubChem CID 46632227) has the molecular formula C22H26F3N3O2 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide.
| Compound Name | N-(4-methoxyphenyl)-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 46632227 |
| Molecular Formula | C22H26F3N3O2 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide |
| SMILES | COc1ccc(NC(=O)C(C)N2CCN(Cc3ccc(C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26F3N3O2/c1-16(21(29)26-19-7-9-20(30-2)10-8-19)28-13-11-27(12-14-28)15-17-3-5-18(6-4-17)22(23,24)25/h3-10,16H,11-15H2,1-2H3,(H,26,29) |
| InChIKey | HFLAKSZLDQMFSI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |