C18H26F3N3O — CID 37113607
(2R)-N-propyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide (PubChem CID 37113607) has the molecular formula C18H26F3N3O and a molecular weight of 357.42 g/mol. Its IUPAC name is (2R)-N-propyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-propyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 37113607 |
| Molecular Formula | C18H26F3N3O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | (2R)-N-propyl-2-[4-[[4-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]propanamide |
| SMILES | CCCNC(=O)[C@@H](C)N1CCN(Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H26F3N3O/c1-3-8-22-17(25)14(2)24-11-9-23(10-12-24)13-15-4-6-16(7-5-15)18(19,20)21/h4-7,14H,3,8-13H2,1-2H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | UDCDEUGPDVOOCI-CQSZACIVSA-N |
| XLogP | 2.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |