C22H21N5OS2 — CID 30989171
2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone (PubChem CID 30989171) has the molecular formula C22H21N5OS2 and a molecular weight of 435.58 g/mol. Its IUPAC name is 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone.
| Compound Name | 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 30989171 |
| Molecular Formula | C22H21N5OS2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
| SMILES | O=C(CSc1nnc(NCc2ccccc2)s1)N1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C22H21N5OS2/c28-20(27-11-10-19-17(13-27)16-8-4-5-9-18(16)24-19)14-29-22-26-25-21(30-22)23-12-15-6-2-1-3-7-15/h1-9,24H,10-14H2,(H,23,25) |
| InChIKey | ZEABPFLQXWTZTL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|