C21H20N6OS — CID 31030499
2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone (PubChem CID 31030499) has the molecular formula C21H20N6OS and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone.
| Compound Name | 2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 31030499 |
| Molecular Formula | C21H20N6OS |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[1-(4-methylphenyl)tetrazol-5-yl]sulfanyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)N2CCc3[nH]c4ccccc4c3C2)cc1 |
| InChI | InChI=1S/C21H20N6OS/c1-14-6-8-15(9-7-14)27-21(23-24-25-27)29-13-20(28)26-11-10-19-17(12-26)16-4-2-3-5-18(16)22-19/h2-9,22H,10-13H2,1H3 |
| InChIKey | LSKCPXSQMGYHPW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|