C24H24N4OS — CID 31455429
2-[1-(2,4-dimethylphenyl)imidazol-2-yl]sulfanyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone (PubChem CID 31455429) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 2-[1-(2,4-dimethylphenyl)imidazol-2-yl]sulfanyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone.
| Compound Name | 2-[1-(2,4-dimethylphenyl)imidazol-2-yl]sulfanyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 31455429 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[1-(2,4-dimethylphenyl)imidazol-2-yl]sulfanyl-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
| SMILES | Cc1ccc(-n2ccnc2SCC(=O)N2CCc3[nH]c4ccccc4c3C2)c(C)c1 |
| InChI | InChI=1S/C24H24N4OS/c1-16-7-8-22(17(2)13-16)28-12-10-25-24(28)30-15-23(29)27-11-9-21-19(14-27)18-5-3-4-6-20(18)26-21/h3-8,10,12-13,26H,9,11,14-15H2,1-2H3 |
| InChIKey | MRZXWKXMPNKZGF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|