C29H26N4O2S — CID 30915629
3-(3,4-dimethylphenyl)-2-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]sulfanylquinazolin-4-one (PubChem CID 30915629) has the molecular formula C29H26N4O2S and a molecular weight of 494.62 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-2-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]sulfanylquinazolin-4-one.
| Compound Name | 3-(3,4-dimethylphenyl)-2-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 30915629 |
| Molecular Formula | C29H26N4O2S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-2-[2-oxo-2-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethyl]sulfanylquinazolin-4-one |
| SMILES | Cc1ccc(-n2c(SCC(=O)N3CCc4[nH]c5ccccc5c4C3)nc3ccccc3c2=O)cc1C |
| InChI | InChI=1S/C29H26N4O2S/c1-18-11-12-20(15-19(18)2)33-28(35)22-8-4-6-10-25(22)31-29(33)36-17-27(34)32-14-13-26-23(16-32)21-7-3-5-9-24(21)30-26/h3-12,15,30H,13-14,16-17H2,1-2H3 |
| InChIKey | OWKHAKPCCAUEDC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|