C21H21N5OS2 — CID 41268497
2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone (PubChem CID 41268497) has the molecular formula C21H21N5OS2 and a molecular weight of 423.57 g/mol. Its IUPAC name is 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone.
| Compound Name | 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 41268497 |
| Molecular Formula | C21H21N5OS2 |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
| SMILES | CCn1c(SCC(=O)N2CCc3[nH]c4ccccc4c3C2)nnc1-c1cccs1 |
| InChI | InChI=1S/C21H21N5OS2/c1-2-26-20(18-8-5-11-28-18)23-24-21(26)29-13-19(27)25-10-9-17-15(12-25)14-6-3-4-7-16(14)22-17/h3-8,11,22H,2,9-10,12-13H2,1H3 |
| InChIKey | KFJNJWRRYJDWIW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|