C23H23FN4OS — CID 30989726
N-(cyanomethyl)-2-[5-(4-fluorophenyl)-1-(2-methylpropyl)imidazol-2-yl]sulfanyl-N-phenylacetamide (PubChem CID 30989726) has the molecular formula C23H23FN4OS and a molecular weight of 422.53 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[5-(4-fluorophenyl)-1-(2-methylpropyl)imidazol-2-yl]sulfanyl-N-phenylacetamide.
| Compound Name | N-(cyanomethyl)-2-[5-(4-fluorophenyl)-1-(2-methylpropyl)imidazol-2-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 30989726 |
| Molecular Formula | C23H23FN4OS |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(cyanomethyl)-2-[5-(4-fluorophenyl)-1-(2-methylpropyl)imidazol-2-yl]sulfanyl-N-phenylacetamide |
| SMILES | CC(C)Cn1c(-c2ccc(F)cc2)cnc1SCC(=O)N(CC#N)c1ccccc1 |
| InChI | InChI=1S/C23H23FN4OS/c1-17(2)15-28-21(18-8-10-19(24)11-9-18)14-26-23(28)30-16-22(29)27(13-12-25)20-6-4-3-5-7-20/h3-11,14,17H,13,15-16H2,1-2H3 |
| InChIKey | MHDNTGXXGDLRCS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|