C21H20N4OS — CID 40664275
N-(cyanomethyl)-2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-phenylacetamide (PubChem CID 40664275) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-phenylacetamide.
| Compound Name | N-(cyanomethyl)-2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 40664275 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-(cyanomethyl)-2-[1-(3,5-dimethylphenyl)imidazol-2-yl]sulfanyl-N-phenylacetamide |
| SMILES | Cc1cc(C)cc(-n2ccnc2SCC(=O)N(CC#N)c2ccccc2)c1 |
| InChI | InChI=1S/C21H20N4OS/c1-16-12-17(2)14-19(13-16)25-11-9-23-21(25)27-15-20(26)24(10-8-22)18-6-4-3-5-7-18/h3-7,9,11-14H,10,15H2,1-2H3 |
| InChIKey | QRBFCCSLWXQWCG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|