C19H18N6OS — CID 31099090
N-(cyanomethyl)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-phenylacetamide (PubChem CID 31099090) has the molecular formula C19H18N6OS and a molecular weight of 378.46 g/mol. Its IUPAC name is N-(cyanomethyl)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-phenylacetamide.
| Compound Name | N-(cyanomethyl)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-phenylacetamide |
|---|---|
| PubChem CID | 31099090 |
| Molecular Formula | C19H18N6OS |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-(cyanomethyl)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanyl-N-phenylacetamide |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)N(CC#N)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H18N6OS/c1-14-8-9-17(15(2)12-14)25-19(21-22-23-25)27-13-18(26)24(11-10-20)16-6-4-3-5-7-16/h3-9,12H,11,13H2,1-2H3 |
| InChIKey | OSJZZWXYAZBYFF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|