C20H17ClN4OS — CID 46812354
2-[1-(3-chloro-2-methylphenyl)imidazol-2-yl]sulfanyl-N-(cyanomethyl)-N-phenylacetamide (PubChem CID 46812354) has the molecular formula C20H17ClN4OS and a molecular weight of 396.90 g/mol. Its IUPAC name is 2-[1-(3-chloro-2-methylphenyl)imidazol-2-yl]sulfanyl-N-(cyanomethyl)-N-phenylacetamide.
| Compound Name | 2-[1-(3-chloro-2-methylphenyl)imidazol-2-yl]sulfanyl-N-(cyanomethyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 46812354 |
| Molecular Formula | C20H17ClN4OS |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[1-(3-chloro-2-methylphenyl)imidazol-2-yl]sulfanyl-N-(cyanomethyl)-N-phenylacetamide |
| SMILES | Cc1c(Cl)cccc1-n1ccnc1SCC(=O)N(CC#N)c1ccccc1 |
| InChI | InChI=1S/C20H17ClN4OS/c1-15-17(21)8-5-9-18(15)25-13-11-23-20(25)27-14-19(26)24(12-10-22)16-6-3-2-4-7-16/h2-9,11,13H,12,14H2,1H3 |
| InChIKey | SVYCVEQXOCAVHP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|