C20H19FN2O2S — CID 30997521
(3R)-1-(2-fluorophenyl)-5-oxo-N-(2-prop-2-enylsulfanylphenyl)pyrrolidine-3-carboxamide (PubChem CID 30997521) has the molecular formula C20H19FN2O2S and a molecular weight of 370.45 g/mol. Its IUPAC name is (3R)-1-(2-fluorophenyl)-5-oxo-N-(2-prop-2-enylsulfanylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-(2-fluorophenyl)-5-oxo-N-(2-prop-2-enylsulfanylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 30997521 |
| Molecular Formula | C20H19FN2O2S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (3R)-1-(2-fluorophenyl)-5-oxo-N-(2-prop-2-enylsulfanylphenyl)pyrrolidine-3-carboxamide |
| SMILES | C=CCSc1ccccc1NC(=O)[C@@H]1CC(=O)N(c2ccccc2F)C1 |
| InChI | InChI=1S/C20H19FN2O2S/c1-2-11-26-18-10-6-4-8-16(18)22-20(25)14-12-19(24)23(13-14)17-9-5-3-7-15(17)21/h2-10,14H,1,11-13H2,(H,22,25)/t14-/m1/s1 |
| InChIKey | IFPJSZIXKJUGBJ-CQSZACIVSA-N |
| XLogP | 4.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|