C19H24N6S — CID 31017899
N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-amine (PubChem CID 31017899) has the molecular formula C19H24N6S and a molecular weight of 368.51 g/mol. Its IUPAC name is N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-amine.
| Compound Name | N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 31017899 |
| Molecular Formula | C19H24N6S |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[2-(4-methyl-1,3-thiazol-5-yl)ethyl]-1-[4-(1,2,4-triazol-1-yl)phenyl]piperidin-4-amine |
| SMILES | Cc1ncsc1CCNC1CCN(c2ccc(-n3cncn3)cc2)CC1 |
| InChI | InChI=1S/C19H24N6S/c1-15-19(26-14-22-15)6-9-21-16-7-10-24(11-8-16)17-2-4-18(5-3-17)25-13-20-12-23-25/h2-5,12-14,16,21H,6-11H2,1H3 |
| InChIKey | PULAEJUECOKUFV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|