C24H26N4O2S — CID 31018283
2-[(3-benzyl-2-ethylsulfonylimidazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 31018283) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-[(3-benzyl-2-ethylsulfonylimidazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[(3-benzyl-2-ethylsulfonylimidazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 31018283 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[(3-benzyl-2-ethylsulfonylimidazol-4-yl)methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCS(=O)(=O)c1ncc(CN2CCc3c([nH]c4ccccc34)C2)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H26N4O2S/c1-2-31(29,30)24-25-14-19(28(24)15-18-8-4-3-5-9-18)16-27-13-12-21-20-10-6-7-11-22(20)26-23(21)17-27/h3-11,14,26H,2,12-13,15-17H2,1H3 |
| InChIKey | UCSKHWKWAZAVLL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|