C24H28ClN5O4 — CID 31035231
2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-(3-methoxypropyl)amino]-N-(3-chloro-4-methylphenyl)acetamide (PubChem CID 31035231) has the molecular formula C24H28ClN5O4 and a molecular weight of 485.97 g/mol. Its IUPAC name is 2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-(3-methoxypropyl)amino]-N-(3-chloro-4-methylphenyl)acetamide.
| Compound Name | 2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-(3-methoxypropyl)amino]-N-(3-chloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 31035231 |
| Molecular Formula | C24H28ClN5O4 |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 2-[(6-amino-1-benzyl-2,4-dioxopyrimidin-5-yl)-(3-methoxypropyl)amino]-N-(3-chloro-4-methylphenyl)acetamide |
| SMILES | COCCCN(CC(=O)Nc1ccc(C)c(Cl)c1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H28ClN5O4/c1-16-9-10-18(13-19(16)25)27-20(31)15-29(11-6-12-34-2)21-22(26)30(24(33)28-23(21)32)14-17-7-4-3-5-8-17/h3-5,7-10,13H,6,11-12,14-15,26H2,1-2H3,(H,27,31)(H,28,32,33) |
| InChIKey | OVQNKAICMSKYGQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|