C23H32N6O3 — CID 56550685
6-amino-1-benzyl-5-[3-methoxypropyl(5-pyrazol-1-ylpentyl)amino]pyrimidine-2,4-dione (PubChem CID 56550685) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-[3-methoxypropyl(5-pyrazol-1-ylpentyl)amino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-[3-methoxypropyl(5-pyrazol-1-ylpentyl)amino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56550685 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 6-amino-1-benzyl-5-[3-methoxypropyl(5-pyrazol-1-ylpentyl)amino]pyrimidine-2,4-dione |
| SMILES | COCCCN(CCCCCn1cccn1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H32N6O3/c1-32-17-9-14-27(13-6-3-7-15-28-16-8-12-25-28)20-21(24)29(23(31)26-22(20)30)18-19-10-4-2-5-11-19/h2,4-5,8,10-12,16H,3,6-7,9,13-15,17-18,24H2,1H3,(H,26,30,31) |
| InChIKey | DBUCLWVLLCZAKI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|