C23H27FN4O4 — CID 36947650
6-amino-1-benzyl-5-[2-(3-fluorophenoxy)ethyl-(3-methoxypropyl)amino]pyrimidine-2,4-dione (PubChem CID 36947650) has the molecular formula C23H27FN4O4 and a molecular weight of 442.49 g/mol. Its IUPAC name is 6-amino-1-benzyl-5-[2-(3-fluorophenoxy)ethyl-(3-methoxypropyl)amino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-5-[2-(3-fluorophenoxy)ethyl-(3-methoxypropyl)amino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 36947650 |
| Molecular Formula | C23H27FN4O4 |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 6-amino-1-benzyl-5-[2-(3-fluorophenoxy)ethyl-(3-methoxypropyl)amino]pyrimidine-2,4-dione |
| SMILES | COCCCN(CCOc1cccc(F)c1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H27FN4O4/c1-31-13-6-11-27(12-14-32-19-10-5-9-18(24)15-19)20-21(25)28(23(30)26-22(20)29)16-17-7-3-2-4-8-17/h2-5,7-10,15H,6,11-14,16,25H2,1H3,(H,26,29,30) |
| InChIKey | JUFAEANRGBOLPZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|