C23H33N5O4 — CID 46527785
6-amino-5-[[2-(azepan-1-yl)-2-oxoethyl]-(3-methoxypropyl)amino]-1-benzylpyrimidine-2,4-dione (PubChem CID 46527785) has the molecular formula C23H33N5O4 and a molecular weight of 443.55 g/mol. Its IUPAC name is 6-amino-5-[[2-(azepan-1-yl)-2-oxoethyl]-(3-methoxypropyl)amino]-1-benzylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[[2-(azepan-1-yl)-2-oxoethyl]-(3-methoxypropyl)amino]-1-benzylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 46527785 |
| Molecular Formula | C23H33N5O4 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 6-amino-5-[[2-(azepan-1-yl)-2-oxoethyl]-(3-methoxypropyl)amino]-1-benzylpyrimidine-2,4-dione |
| SMILES | COCCCN(CC(=O)N1CCCCCC1)c1c(N)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H33N5O4/c1-32-15-9-14-27(17-19(29)26-12-7-2-3-8-13-26)20-21(24)28(23(31)25-22(20)30)16-18-10-5-4-6-11-18/h4-6,10-11H,2-3,7-9,12-17,24H2,1H3,(H,25,30,31) |
| InChIKey | DTMSXFKIGIAAJW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|