C25H19Br2NO3 — CID 3105004
16-(benzylcarbamoyl)-1,8-dibromotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid (PubChem CID 3105004) has the molecular formula C25H19Br2NO3 and a molecular weight of 541.24 g/mol. Its IUPAC name is 16-(benzylcarbamoyl)-1,8-dibromotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid.
| Compound Name | 16-(benzylcarbamoyl)-1,8-dibromotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid |
|---|---|
| PubChem CID | 3105004 |
| Molecular Formula | C25H19Br2NO3 |
| Molecular Weight | 541.24 g/mol |
| Exact Mass | 538.97 |
| IUPAC Name | 16-(benzylcarbamoyl)-1,8-dibromotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylic acid |
| SMILES | O=C(O)C1C(C(=O)NCc2ccccc2)C2(Br)c3ccccc3C1(Br)c1ccccc12 |
| InChI | InChI=1S/C25H19Br2NO3/c26-24-16-10-4-6-12-18(16)25(27,19-13-7-5-11-17(19)24)21(23(30)31)20(24)22(29)28-14-15-8-2-1-3-9-15/h1-13,20-21H,14H2,(H,28,29)(H,30,31) |
| InChIKey | GCGLGKMZCPDQRT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.24 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|