C15H15N3O4 — CID 3105199
methyl 5-(2,4-dimethylphenyl)-4,6-dioxo-3,3a-dihydro-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 3105199) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is methyl 5-(2,4-dimethylphenyl)-4,6-dioxo-3,3a-dihydro-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | methyl 5-(2,4-dimethylphenyl)-4,6-dioxo-3,3a-dihydro-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 3105199 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | methyl 5-(2,4-dimethylphenyl)-4,6-dioxo-3,3a-dihydro-2H-pyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | COC(=O)C1NN=C2C(=O)N(c3ccc(C)cc3C)C(=O)C21 |
| InChI | InChI=1S/C15H15N3O4/c1-7-4-5-9(8(2)6-7)18-13(19)10-11(14(18)20)16-17-12(10)15(21)22-3/h4-6,10,12,17H,1-3H3 |
| InChIKey | GULFTNZDMJNZDZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|