C16H15N3O4 — CID 698857
ethyl (3aS)-5-(2,4-dimethylphenyl)-4,6-dioxo-3aH-pyrrolo[3,4-c]pyrazole-3-carboxylate (PubChem CID 698857) has the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. Its IUPAC name is ethyl (3aS)-5-(2,4-dimethylphenyl)-4,6-dioxo-3aH-pyrrolo[3,4-c]pyrazole-3-carboxylate.
| Compound Name | ethyl (3aS)-5-(2,4-dimethylphenyl)-4,6-dioxo-3aH-pyrrolo[3,4-c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 698857 |
| Molecular Formula | C16H15N3O4 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | ethyl (3aS)-5-(2,4-dimethylphenyl)-4,6-dioxo-3aH-pyrrolo[3,4-c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN=C2C(=O)N(c3ccc(C)cc3C)C(=O)[C@H]12 |
| InChI | InChI=1S/C16H15N3O4/c1-4-23-16(22)13-11-12(17-18-13)15(21)19(14(11)20)10-6-5-8(2)7-9(10)3/h5-7,11H,4H2,1-3H3/t11-/m0/s1 |
| InChIKey | KOXQRMOKPGIDGY-NSHDSACASA-N |
| XLogP | 1.17 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|