C21H24N4OS — CID 31054593
pyrrolidin-1-yl-[5-[[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone (PubChem CID 31054593) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is pyrrolidin-1-yl-[5-[[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone.
| Compound Name | pyrrolidin-1-yl-[5-[[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone |
|---|---|
| PubChem CID | 31054593 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | pyrrolidin-1-yl-[5-[[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]imidazo[2,1-b][1,3]thiazol-6-yl]methanone |
| SMILES | O=C(c1nc2sccn2c1CN[C@@H]1CCCc2ccccc21)N1CCCC1 |
| InChI | InChI=1S/C21H24N4OS/c26-20(24-10-3-4-11-24)19-18(25-12-13-27-21(25)23-19)14-22-17-9-5-7-15-6-1-2-8-16(15)17/h1-2,6,8,12-13,17,22H,3-5,7,9-11,14H2/t17-/m1/s1 |
| InChIKey | ADIUYRUZVPVWKM-QGZVFWFLSA-N |
| XLogP | 3.80 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |