C22H29N5O — CID 31054711
1-methyl-3-[4-[4-(2-pyridin-2-ylethylamino)piperidin-1-yl]phenyl]imidazolidin-2-one (PubChem CID 31054711) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-methyl-3-[4-[4-(2-pyridin-2-ylethylamino)piperidin-1-yl]phenyl]imidazolidin-2-one.
| Compound Name | 1-methyl-3-[4-[4-(2-pyridin-2-ylethylamino)piperidin-1-yl]phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 31054711 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-methyl-3-[4-[4-(2-pyridin-2-ylethylamino)piperidin-1-yl]phenyl]imidazolidin-2-one |
| SMILES | CN1CCN(c2ccc(N3CCC(NCCc4ccccn4)CC3)cc2)C1=O |
| InChI | InChI=1S/C22H29N5O/c1-25-16-17-27(22(25)28)21-7-5-20(6-8-21)26-14-10-19(11-15-26)24-13-9-18-4-2-3-12-23-18/h2-8,12,19,24H,9-11,13-17H2,1H3 |
| InChIKey | UCEKKMJITMFYJK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|