C24H31NO6 — CID 3105935
butyl 2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 3105935) has the molecular formula C24H31NO6 and a molecular weight of 429.51 g/mol. Its IUPAC name is butyl 2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | butyl 2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 3105935 |
| Molecular Formula | C24H31NO6 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | butyl 2-methyl-5-oxo-4-(3,4,5-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)NC2=C(C(=O)CCC2)C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H31NO6/c1-6-7-11-31-24(27)20-14(2)25-16-9-8-10-17(26)22(16)21(20)15-12-18(28-3)23(30-5)19(13-15)29-4/h12-13,21,25H,6-11H2,1-5H3 |
| InChIKey | YLMOGPUDDKTLFL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|