C19H23NO3 — CID 3108314
N-(1,3-benzodioxol-5-ylmethyl)adamantane-1-carboxamide (PubChem CID 3108314) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)adamantane-1-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 3108314 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)adamantane-1-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H23NO3/c21-18(19-7-13-3-14(8-19)5-15(4-13)9-19)20-10-12-1-2-16-17(6-12)23-11-22-16/h1-2,6,13-15H,3-5,7-11H2,(H,20,21) |
| InChIKey | IHVKROPZRZOWMQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |