C19H15IN2O3 — CID 3108609
3-iodo-N'-(2-naphthalen-2-yloxyacetyl)benzohydrazide (PubChem CID 3108609) has the molecular formula C19H15IN2O3 and a molecular weight of 446.24 g/mol. Its IUPAC name is 3-iodo-N'-(2-naphthalen-2-yloxyacetyl)benzohydrazide.
| Compound Name | 3-iodo-N'-(2-naphthalen-2-yloxyacetyl)benzohydrazide |
|---|---|
| PubChem CID | 3108609 |
| Molecular Formula | C19H15IN2O3 |
| Molecular Weight | 446.24 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 3-iodo-N'-(2-naphthalen-2-yloxyacetyl)benzohydrazide |
| SMILES | O=C(COc1ccc2ccccc2c1)NNC(=O)c1cccc(I)c1 |
| InChI | InChI=1S/C19H15IN2O3/c20-16-7-3-6-15(10-16)19(24)22-21-18(23)12-25-17-9-8-13-4-1-2-5-14(13)11-17/h1-11H,12H2,(H,21,23)(H,22,24) |
| InChIKey | INNZGLMCBQENSI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|