C14H19N3OS2 — CID 3110211
N-(5-heptan-3-yl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide (PubChem CID 3110211) has the molecular formula C14H19N3OS2 and a molecular weight of 309.46 g/mol. Its IUPAC name is N-(5-heptan-3-yl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(5-heptan-3-yl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3110211 |
| Molecular Formula | C14H19N3OS2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-(5-heptan-3-yl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
| SMILES | CCCCC(CC)c1nnc(NC(=O)c2cccs2)s1 |
| InChI | InChI=1S/C14H19N3OS2/c1-3-5-7-10(4-2)13-16-17-14(20-13)15-12(18)11-8-6-9-19-11/h6,8-10H,3-5,7H2,1-2H3,(H,15,17,18) |
| InChIKey | WEKAPFWWYGJNGM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |