C19H29N7 — CID 31162737
1-[[1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methyl]azepane (PubChem CID 31162737) has the molecular formula C19H29N7 and a molecular weight of 355.49 g/mol. Its IUPAC name is 1-[[1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methyl]azepane.
| Compound Name | 1-[[1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methyl]azepane |
|---|---|
| PubChem CID | 31162737 |
| Molecular Formula | C19H29N7 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 1-[[1-[(1-pyrazin-2-ylpiperidin-4-yl)methyl]triazol-4-yl]methyl]azepane |
| SMILES | c1cnc(N2CCC(Cn3cc(CN4CCCCCC4)nn3)CC2)cn1 |
| InChI | InChI=1S/C19H29N7/c1-2-4-10-24(9-3-1)15-18-16-26(23-22-18)14-17-5-11-25(12-6-17)19-13-20-7-8-21-19/h7-8,13,16-17H,1-6,9-12,14-15H2 |
| InChIKey | GWFIMZWYVXOZNY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |