C18H15Br2N3O2 — CID 3116479
4-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-1-(4-bromophenyl)pyrazolidine-3,5-dione (PubChem CID 3116479) has the molecular formula C18H15Br2N3O2 and a molecular weight of 465.15 g/mol. Its IUPAC name is 4-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-1-(4-bromophenyl)pyrazolidine-3,5-dione.
| Compound Name | 4-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-1-(4-bromophenyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 3116479 |
| Molecular Formula | C18H15Br2N3O2 |
| Molecular Weight | 465.15 g/mol |
| Exact Mass | 462.95 |
| IUPAC Name | 4-[[3-bromo-4-(dimethylamino)phenyl]methylidene]-1-(4-bromophenyl)pyrazolidine-3,5-dione |
| SMILES | CN(C)c1ccc(C=C2C(=O)NN(c3ccc(Br)cc3)C2=O)cc1Br |
| InChI | InChI=1S/C18H15Br2N3O2/c1-22(2)16-8-3-11(10-15(16)20)9-14-17(24)21-23(18(14)25)13-6-4-12(19)5-7-13/h3-10H,1-2H3,(H,21,24) |
| InChIKey | KVXFDGYJOVOZJE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.15 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|