C12H15N3O5 — CID 3117716
N-(2-hydroxyethyl)-2-[2-(4-methoxybenzoyl)hydrazinyl]-2-oxoacetamide (PubChem CID 3117716) has the molecular formula C12H15N3O5 and a molecular weight of 281.27 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[2-(4-methoxybenzoyl)hydrazinyl]-2-oxoacetamide.
| Compound Name | N-(2-hydroxyethyl)-2-[2-(4-methoxybenzoyl)hydrazinyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 3117716 |
| Molecular Formula | C12H15N3O5 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[2-(4-methoxybenzoyl)hydrazinyl]-2-oxoacetamide |
| SMILES | COc1ccc(C(=O)NNC(=O)C(=O)NCCO)cc1 |
| InChI | InChI=1S/C12H15N3O5/c1-20-9-4-2-8(3-5-9)10(17)14-15-12(19)11(18)13-6-7-16/h2-5,16H,6-7H2,1H3,(H,13,18)(H,14,17)(H,15,19) |
| InChIKey | QTKSYPLYNKQNOG-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|