C7H12N2O3S — CID 3119467
3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylurea (PubChem CID 3119467) has the molecular formula C7H12N2O3S and a molecular weight of 204.25 g/mol. Its IUPAC name is 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylurea.
| Compound Name | 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 3119467 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C7H12N2O3S/c1-9(2)7(10)8-6-3-4-13(11,12)5-6/h3-4,6H,5H2,1-2H3,(H,8,10) |
| InChIKey | UHOQIDMEZMQGLE-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |