C14H13NO4 — CID 31196222
(1,2-diacetylindol-3-yl) acetate (PubChem CID 31196222) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is (1,2-diacetylindol-3-yl) acetate.
| Compound Name | (1,2-diacetylindol-3-yl) acetate |
|---|---|
| PubChem CID | 31196222 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (1,2-diacetylindol-3-yl) acetate |
| SMILES | CC(=O)Oc1c(C(C)=O)n(C(C)=O)c2ccccc12 |
| InChI | InChI=1S/C14H13NO4/c1-8(16)13-14(19-10(3)18)11-6-4-5-7-12(11)15(13)9(2)17/h4-7H,1-3H3 |
| InChIKey | SDLJOISUCPYHPJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |