C14H17N3O2S — CID 31196599
(E)-N-(morpholin-4-ylcarbamothioyl)-3-phenylprop-2-enamide (PubChem CID 31196599) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is (E)-N-(morpholin-4-ylcarbamothioyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(morpholin-4-ylcarbamothioyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 31196599 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (E)-N-(morpholin-4-ylcarbamothioyl)-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)NN1CCOCC1 |
| InChI | InChI=1S/C14H17N3O2S/c18-13(7-6-12-4-2-1-3-5-12)15-14(20)16-17-8-10-19-11-9-17/h1-7H,8-11H2,(H2,15,16,18,20)/b7-6+ |
| InChIKey | CGJSEZMSJKPNCE-VOTSOKGWSA-N |
| XLogP | 0.94 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|