C22H20IN3O3S — CID 3124383
[(10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17)-trien-16-ylidene)amino] 3-iodobenzoate (PubChem CID 3124383) has the molecular formula C22H20IN3O3S and a molecular weight of 533.39 g/mol. Its IUPAC name is [(10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17)-trien-16-ylidene)amino] 3-iodobenzoate.
| Compound Name | [(10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17)-trien-16-ylidene)amino] 3-iodobenzoate |
|---|---|
| PubChem CID | 3124383 |
| Molecular Formula | C22H20IN3O3S |
| Molecular Weight | 533.39 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | [(10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17)-trien-16-ylidene)amino] 3-iodobenzoate |
| SMILES | O=C(ON=C1CCCc2c1sc1nc3n(c(=O)c21)CCCCC3)c1cccc(I)c1 |
| InChI | InChI=1S/C22H20IN3O3S/c23-14-7-4-6-13(12-14)22(28)29-25-16-9-5-8-15-18-20(30-19(15)16)24-17-10-2-1-3-11-26(17)21(18)27/h4,6-7,12H,1-3,5,8-11H2 |
| InChIKey | SWMYEKWJRHNXTG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|