C22H20N2O3S2 — CID 44542941
16-(2-hydroxyphenyl)sulfanyl-10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17),15-tetraene-15-carbaldehyde (PubChem CID 44542941) has the molecular formula C22H20N2O3S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 16-(2-hydroxyphenyl)sulfanyl-10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17),15-tetraene-15-carbaldehyde.
| Compound Name | 16-(2-hydroxyphenyl)sulfanyl-10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17),15-tetraene-15-carbaldehyde |
|---|---|
| PubChem CID | 44542941 |
| Molecular Formula | C22H20N2O3S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 16-(2-hydroxyphenyl)sulfanyl-10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17),15-tetraene-15-carbaldehyde |
| SMILES | O=CC1=C(Sc2ccccc2O)c2sc3nc4n(c(=O)c3c2CC1)CCCCC4 |
| InChI | InChI=1S/C22H20N2O3S2/c25-12-13-9-10-14-18-21(23-17-8-2-1-5-11-24(17)22(18)27)29-20(14)19(13)28-16-7-4-3-6-15(16)26/h3-4,6-7,12,26H,1-2,5,8-11H2 |
| InChIKey | ACTOFYDEBSWFFO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|