C19H20N2O4S2 — CID 44542644
3-[(15-formyl-10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17),15-tetraen-16-yl)sulfanyl]propanoic acid (PubChem CID 44542644) has the molecular formula C19H20N2O4S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-[(15-formyl-10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17),15-tetraen-16-yl)sulfanyl]propanoic acid.
| Compound Name | 3-[(15-formyl-10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17),15-tetraen-16-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 44542644 |
| Molecular Formula | C19H20N2O4S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 3-[(15-formyl-10-oxo-18-thia-2,9-diazatetracyclo[9.7.0.03,9.012,17]octadeca-1(11),2,12(17),15-tetraen-16-yl)sulfanyl]propanoic acid |
| SMILES | O=CC1=C(SCCC(=O)O)c2sc3nc4n(c(=O)c3c2CC1)CCCCC4 |
| InChI | InChI=1S/C19H20N2O4S2/c22-10-11-5-6-12-15-18(27-17(12)16(11)26-9-7-14(23)24)20-13-4-2-1-3-8-21(13)19(15)25/h10H,1-9H2,(H,23,24) |
| InChIKey | KOHMJZQRKKIGGY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|