C30H21BrF2N2O3 — CID 3124411
[2-[1-[2-(4-bromophenoxy)ethyl]benzimidazol-2-yl]-1-(4-fluorophenyl)ethenyl] 4-fluorobenzoate (PubChem CID 3124411) has the molecular formula C30H21BrF2N2O3 and a molecular weight of 575.41 g/mol. Its IUPAC name is [2-[1-[2-(4-bromophenoxy)ethyl]benzimidazol-2-yl]-1-(4-fluorophenyl)ethenyl] 4-fluorobenzoate.
| Compound Name | [2-[1-[2-(4-bromophenoxy)ethyl]benzimidazol-2-yl]-1-(4-fluorophenyl)ethenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 3124411 |
| Molecular Formula | C30H21BrF2N2O3 |
| Molecular Weight | 575.41 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | [2-[1-[2-(4-bromophenoxy)ethyl]benzimidazol-2-yl]-1-(4-fluorophenyl)ethenyl] 4-fluorobenzoate |
| SMILES | O=C(OC(=Cc1nc2ccccc2n1CCOc1ccc(Br)cc1)c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C30H21BrF2N2O3/c31-22-9-15-25(16-10-22)37-18-17-35-27-4-2-1-3-26(27)34-29(35)19-28(20-5-11-23(32)12-6-20)38-30(36)21-7-13-24(33)14-8-21/h1-16,19H,17-18H2 |
| InChIKey | ORELROXGZJPNQW-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.41 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|