C33H28F2N2O2 — CID 4655806
[2-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]-1-(4-fluorophenyl)ethenyl] 4-fluorobenzoate (PubChem CID 4655806) has the molecular formula C33H28F2N2O2 and a molecular weight of 522.60 g/mol. Its IUPAC name is [2-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]-1-(4-fluorophenyl)ethenyl] 4-fluorobenzoate.
| Compound Name | [2-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]-1-(4-fluorophenyl)ethenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 4655806 |
| Molecular Formula | C33H28F2N2O2 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | [2-[1-[(4-tert-butylphenyl)methyl]benzimidazol-2-yl]-1-(4-fluorophenyl)ethenyl] 4-fluorobenzoate |
| SMILES | CC(C)(C)c1ccc(Cn2c(C=C(OC(=O)c3ccc(F)cc3)c3ccc(F)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C33H28F2N2O2/c1-33(2,3)25-14-8-22(9-15-25)21-37-29-7-5-4-6-28(29)36-31(37)20-30(23-10-16-26(34)17-11-23)39-32(38)24-12-18-27(35)19-13-24/h4-20H,21H2,1-3H3 |
| InChIKey | SVERRLXFFTWXSD-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|