C29H22N+ — CID 3124420
1,2,4,6-tetraphenylpyridin-1-ium (PubChem CID 3124420) has the molecular formula C29H22N+ and a molecular weight of 384.50 g/mol. Its IUPAC name is 1,2,4,6-tetraphenylpyridin-1-ium.
| Compound Name | 1,2,4,6-tetraphenylpyridin-1-ium |
|---|---|
| PubChem CID | 3124420 |
| Molecular Formula | C29H22N+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1,2,4,6-tetraphenylpyridin-1-ium |
| SMILES | c1ccc(-c2cc(-c3ccccc3)[n+](-c3ccccc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H22N/c1-5-13-23(14-6-1)26-21-28(24-15-7-2-8-16-24)30(27-19-11-4-12-20-27)29(22-26)25-17-9-3-10-18-25/h1-22H/q+1 |
| InChIKey | RQZVZXMZBKLHPE-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|