C24H29N5O2S — CID 31274039
2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-cyclopentylpyrazol-3-yl)acetamide (PubChem CID 31274039) has the molecular formula C24H29N5O2S and a molecular weight of 451.60 g/mol. Its IUPAC name is 2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-cyclopentylpyrazol-3-yl)acetamide.
| Compound Name | 2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-cyclopentylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 31274039 |
| Molecular Formula | C24H29N5O2S |
| Molecular Weight | 451.60 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 2-(3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-(2-cyclopentylpyrazol-3-yl)acetamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1C1CCCCC1)Nc1ccnn1C1CCCC1 |
| InChI | InChI=1S/C24H29N5O2S/c30-22(27-21-14-15-25-29(21)18-10-4-5-11-18)16-32-24-26-20-13-7-6-12-19(20)23(31)28(24)17-8-2-1-3-9-17/h6-7,12-15,17-18H,1-5,8-11,16H2,(H,27,30) |
| InChIKey | SZQPNWRSVWFFNU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |