C26H25F3N4O3 — CID 3127855
2-ethoxy-6-[(4-morpholin-4-ylphenyl)iminomethyl]-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol (PubChem CID 3127855) has the molecular formula C26H25F3N4O3 and a molecular weight of 498.51 g/mol. Its IUPAC name is 2-ethoxy-6-[(4-morpholin-4-ylphenyl)iminomethyl]-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol.
| Compound Name | 2-ethoxy-6-[(4-morpholin-4-ylphenyl)iminomethyl]-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol |
|---|---|
| PubChem CID | 3127855 |
| Molecular Formula | C26H25F3N4O3 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-ethoxy-6-[(4-morpholin-4-ylphenyl)iminomethyl]-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol |
| SMILES | CCOc1cc(/N=N/c2cccc(C(F)(F)F)c2)cc(/C=N/c2ccc(N3CCOCC3)cc2)c1O |
| InChI | InChI=1S/C26H25F3N4O3/c1-2-36-24-16-22(32-31-21-5-3-4-19(15-21)26(27,28)29)14-18(25(24)34)17-30-20-6-8-23(9-7-20)33-10-12-35-13-11-33/h3-9,14-17,34H,2,10-13H2,1H3/b30-17+,32-31+ |
| InChIKey | CXBGUBGGULYNTI-PYLJCRHBSA-N |
| XLogP | 6.81 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|